C20H14ClN3O4 — CID 135655445
3-chloro-N-[4-hydroxy-3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]-4-methoxybenzamide (PubChem CID 135655445) has the molecular formula C20H14ClN3O4 and a molecular weight of 395.80 g/mol. Its IUPAC name is 3-chloro-N-[4-hydroxy-3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]-4-methoxybenzamide.
| Compound Name | 3-chloro-N-[4-hydroxy-3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 135655445 |
| Molecular Formula | C20H14ClN3O4 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 3-chloro-N-[4-hydroxy-3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(O)c(-c3nc4cnccc4o3)c2)cc1Cl |
| InChI | InChI=1S/C20H14ClN3O4/c1-27-17-5-2-11(8-14(17)21)19(26)23-12-3-4-16(25)13(9-12)20-24-15-10-22-7-6-18(15)28-20/h2-10,25H,1H3,(H,23,26) |
| InChIKey | IRWZGRVGBDICHD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|