C29H32F3N5O3 — CID 42659925
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 42659925) has the molecular formula C29H32F3N5O3 and a molecular weight of 555.60 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42659925 |
| Molecular Formula | C29H32F3N5O3 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccccc3C(F)(F)F)cc2C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C29H32F3N5O3/c1-19(2)33-27(38)21-18-20(34-28(39)35-23-9-5-4-8-22(23)29(30,31)32)12-13-24(21)36-14-16-37(17-15-36)25-10-6-7-11-26(25)40-3/h4-13,18-19H,14-17H2,1-3H3,(H,33,38)(H2,34,35,39) |
| InChIKey | MSTWHNLKUYCVGY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|