C29H29FN4O4 — CID 6255695
N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 6255695) has the molecular formula C29H29FN4O4 and a molecular weight of 516.57 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 6255695 |
| Molecular Formula | C29H29FN4O4 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H29FN4O4/c1-20-14-16-33(17-15-20)27-12-9-24(18-26(27)29(36)31-19-22-2-7-23(30)8-3-22)32-28(35)13-6-21-4-10-25(11-5-21)34(37)38/h2-13,18,20H,14-17,19H2,1H3,(H,31,36)(H,32,35)/b13-6+ |
| InChIKey | GBHYEKZPICGKAP-AWNIVKPZSA-N |
| XLogP | 5.55 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|