C43H63N7O6 — CID 57292609
tritert-butyl 11-[[4-[amino(dipyridin-2-yl)methyl]phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate (PubChem CID 57292609) has the molecular formula C43H63N7O6 and a molecular weight of 774.02 g/mol. Its IUPAC name is tritert-butyl 11-[[4-[amino(dipyridin-2-yl)methyl]phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate.
| Compound Name | tritert-butyl 11-[[4-[amino(dipyridin-2-yl)methyl]phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
|---|---|
| PubChem CID | 57292609 |
| Molecular Formula | C43H63N7O6 |
| Molecular Weight | 774.02 g/mol |
| Exact Mass | 773.48 |
| IUPAC Name | tritert-butyl 11-[[4-[amino(dipyridin-2-yl)methyl]phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCCN(Cc2ccc(C(N)(c3ccccn3)c3ccccn3)cc2)CC1 |
| InChI | InChI=1S/C43H63N7O6/c1-40(2,3)54-37(51)48-26-15-27-50(39(53)56-42(7,8)9)31-30-49(38(52)55-41(4,5)6)25-14-24-47(28-29-48)32-33-18-20-34(21-19-33)43(44,35-16-10-12-22-45-35)36-17-11-13-23-46-36/h10-13,16-23H,14-15,24-32,44H2,1-9H3 |
| InChIKey | ZGEAQYRNBJZYEV-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.02 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|