C21H34N2O3 — CID 174177335
tert-butyl 8-benzyl-1-oxa-4,8-diazacyclododecane-4-carboxylate (PubChem CID 174177335) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is tert-butyl 8-benzyl-1-oxa-4,8-diazacyclododecane-4-carboxylate.
| Compound Name | tert-butyl 8-benzyl-1-oxa-4,8-diazacyclododecane-4-carboxylate |
|---|---|
| PubChem CID | 174177335 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tert-butyl 8-benzyl-1-oxa-4,8-diazacyclododecane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(Cc2ccccc2)CCCCOCC1 |
| InChI | InChI=1S/C21H34N2O3/c1-21(2,3)26-20(24)23-14-9-13-22(12-7-8-16-25-17-15-23)18-19-10-5-4-6-11-19/h4-6,10-11H,7-9,12-18H2,1-3H3 |
| InChIKey | OLASYYRUYYWHAM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |