C28H46N4O6 — CID 122461734
benzyl 4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]-1,4,7-triazonane-1-carboxylate (PubChem CID 122461734) has the molecular formula C28H46N4O6 and a molecular weight of 534.70 g/mol. Its IUPAC name is benzyl 4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]-1,4,7-triazonane-1-carboxylate.
| Compound Name | benzyl 4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]-1,4,7-triazonane-1-carboxylate |
|---|---|
| PubChem CID | 122461734 |
| Molecular Formula | C28H46N4O6 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | benzyl 4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]-1,4,7-triazonane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CN(CCN1CCNCCN(C(=O)OCc2ccccc2)CC1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H46N4O6/c1-27(2,3)37-24(33)20-31(21-25(34)38-28(4,5)6)17-16-30-14-12-29-13-15-32(19-18-30)26(35)36-22-23-10-8-7-9-11-23/h7-11,29H,12-22H2,1-6H3 |
| InChIKey | ORRYXHDTJACJFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|