C20H27N5 — CID 95203310
N-benzyl-5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]methyl]pyrimidin-2-amine (PubChem CID 95203310) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-benzyl-5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]methyl]pyrimidin-2-amine.
| Compound Name | N-benzyl-5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95203310 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-benzyl-5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]methyl]pyrimidin-2-amine |
| SMILES | c1ccc(CNc2ncc(CN3CCC[C@]4(CCNC4)C3)cn2)cc1 |
| InChI | InChI=1S/C20H27N5/c1-2-5-17(6-3-1)11-22-19-23-12-18(13-24-19)14-25-10-4-7-20(16-25)8-9-21-15-20/h1-3,5-6,12-13,21H,4,7-11,14-16H2,(H,22,23,24)/t20-/m1/s1 |
| InChIKey | NMRUVRKARZRJRD-HXUWFJFHSA-N |
| XLogP | 2.66 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |