C16H25N3O — CID 102849320
2-[(6-methoxy-3-pyridinyl)methyl]-2,8-diazaspiro[5.5]undecane (PubChem CID 102849320) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-[(6-methoxy-3-pyridinyl)methyl]-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-[(6-methoxy-3-pyridinyl)methyl]-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102849320 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-[(6-methoxy-3-pyridinyl)methyl]-2,8-diazaspiro[5.5]undecane |
| SMILES | COc1ccc(CN2CCCC3(CCCNC3)C2)cn1 |
| InChI | InChI=1S/C16H25N3O/c1-20-15-5-4-14(10-18-15)11-19-9-3-7-16(13-19)6-2-8-17-12-16/h4-5,10,17H,2-3,6-9,11-13H2,1H3 |
| InChIKey | RJWKCZZGKSYODY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |