About methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate
methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate (PubChem CID 102850104) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate |
| PubChem CID | 102850104 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCCC3(CCCNC3)C2)o1 |
| InChI | InChI=1S/C16H24N2O3/c1-20-15(19)14-5-4-13(21-14)10-18-9-3-7-16(12-18)6-2-8-17-11-16/h4-5,17H,2-3,6-12H2,1H3 |
| InChIKey | ZYJWWQYCXOTGSR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate?
The IUPAC name of methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate (CID 102850104) is methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate.
What is the SMILES notation for methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate?
The canonical SMILES for methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate is COC(=O)c1ccc(CN2CCCC3(CCCNC3)C2)o1.
What is the InChIKey of methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate?
The InChIKey is ZYJWWQYCXOTGSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-20-15(19)14-5-4-13(21-14)10-18-9-3-7-16(12-18)6-2-8-17-11-16/h4-5,17H,2-3,6-12H2,1H3.
What are the key properties of methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate?
methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate has a molecular weight of 292.38 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)furan-2-carboxylate is sourced from PubChem (CID 102850104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).