About 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol
2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol (PubChem CID 102849304) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol |
| PubChem CID | 102849304 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol |
| SMILES | OCCn1cc(CN2CCCC3(CCCNC3)C2)cn1 |
| InChI | InChI=1S/C15H26N4O/c20-8-7-19-11-14(9-17-19)10-18-6-2-4-15(13-18)3-1-5-16-12-15/h9,11,16,20H,1-8,10,12-13H2 |
| InChIKey | PPSHFXZEWVXTMG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol?
The IUPAC name of 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol (CID 102849304) is 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol is OCCn1cc(CN2CCCC3(CCCNC3)C2)cn1.
What is the InChIKey of 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol?
The InChIKey is PPSHFXZEWVXTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O/c20-8-7-19-11-14(9-17-19)10-18-6-2-4-15(13-18)3-1-5-16-12-15/h9,11,16,20H,1-8,10,12-13H2.
What are the key properties of 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol?
2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol has a molecular weight of 278.40 g/mol, XLogP of 0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,8-diazaspiro[5.5]undecan-2-ylmethyl)pyrazol-1-yl]ethanol is sourced from PubChem (CID 102849304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).