C15H22N2 — CID 98089072
(5S,8R)-2-benzyl-2-azaspiro[4.4]nonan-8-amine (PubChem CID 98089072) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (5S,8R)-2-benzyl-2-azaspiro[4.4]nonan-8-amine.
| Compound Name | (5S,8R)-2-benzyl-2-azaspiro[4.4]nonan-8-amine |
|---|---|
| PubChem CID | 98089072 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (5S,8R)-2-benzyl-2-azaspiro[4.4]nonan-8-amine |
| SMILES | N[C@@H]1CC[C@]2(CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C15H22N2/c16-14-6-7-15(10-14)8-9-17(12-15)11-13-4-2-1-3-5-13/h1-5,14H,6-12,16H2/t14-,15+/m1/s1 |
| InChIKey | AHXUSIGCLDCNNO-CABCVRRESA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |