C15H22N2O2 — CID 82666438
9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-amine (PubChem CID 82666438) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-amine.
| Compound Name | 9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-amine |
|---|---|
| PubChem CID | 82666438 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-amine |
| SMILES | NC1COC2(CCN(Cc3ccccc3)CC2)OC1 |
| InChI | InChI=1S/C15H22N2O2/c16-14-11-18-15(19-12-14)6-8-17(9-7-15)10-13-4-2-1-3-5-13/h1-5,14H,6-12,16H2 |
| InChIKey | OJLBQBLVNHGOIV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |