C16H24N2O2 — CID 82667511
(9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanamine (PubChem CID 82667511) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanamine.
| Compound Name | (9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanamine |
|---|---|
| PubChem CID | 82667511 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanamine |
| SMILES | NCC1COC2(CCN(Cc3ccccc3)CC2)OC1 |
| InChI | InChI=1S/C16H24N2O2/c17-10-15-12-19-16(20-13-15)6-8-18(9-7-16)11-14-4-2-1-3-5-14/h1-5,15H,6-13,17H2 |
| InChIKey | VONYJSXGLLRZJS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |