C19H27N3O2 — CID 94118979
(3R)-1-N-[(R)-cyclohexyl(phenyl)methyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 94118979) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (3R)-1-N-[(R)-cyclohexyl(phenyl)methyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[(R)-cyclohexyl(phenyl)methyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94118979 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (3R)-1-N-[(R)-cyclohexyl(phenyl)methyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)N[C@@H](c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C19H27N3O2/c20-18(23)16-11-12-22(13-16)19(24)21-17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1,3-4,7-8,15-17H,2,5-6,9-13H2,(H2,20,23)(H,21,24)/t16-,17+/m1/s1 |
| InChIKey | PLDWSSVPRPCAQU-SJORKVTESA-N |
| XLogP | 2.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |