C14H14N4O5 — CID 133269517
(2R)-4-amino-4-oxo-2-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]butanoic acid (PubChem CID 133269517) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is (2R)-4-amino-4-oxo-2-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]butanoic acid.
| Compound Name | (2R)-4-amino-4-oxo-2-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 133269517 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2R)-4-amino-4-oxo-2-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]butanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)Cc1n[nH]c(=O)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H14N4O5/c15-11(19)5-10(14(22)23)16-12(20)6-9-7-3-1-2-4-8(7)13(21)18-17-9/h1-4,10H,5-6H2,(H2,15,19)(H,16,20)(H,18,21)(H,22,23)/t10-/m1/s1 |
| InChIKey | CSUXLPUXNKALMB-SNVBAGLBSA-N |
| XLogP | -1.09 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |