C15H19N3O3S — CID 91822227
N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 91822227) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 91822227 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | CSCCC(CO)NC(=O)Cc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H19N3O3S/c1-22-7-6-10(9-19)16-14(20)8-13-11-4-2-3-5-12(11)15(21)18-17-13/h2-5,10,19H,6-9H2,1H3,(H,16,20)(H,18,21) |
| InChIKey | NTEPURYJQFFXDL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |