C16H20N4O4 — CID 171138517
N-(1-hydroxypropan-2-yl)-3-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]propanamide (PubChem CID 171138517) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-3-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]propanamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-3-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 171138517 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-3-[[2-(4-oxo-3H-phthalazin-1-yl)acetyl]amino]propanamide |
| SMILES | CC(CO)NC(=O)CCNC(=O)Cc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H20N4O4/c1-10(9-21)18-14(22)6-7-17-15(23)8-13-11-4-2-3-5-12(11)16(24)20-19-13/h2-5,10,21H,6-9H2,1H3,(H,17,23)(H,18,22)(H,20,24) |
| InChIKey | QLRKSAPATNXSOP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |