C22H21N5O3 — CID 16671484
2-(4-oxo-3H-phthalazin-1-yl)-N-[(2R)-1-(1-oxophthalazin-2-yl)butan-2-yl]acetamide (PubChem CID 16671484) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(4-oxo-3H-phthalazin-1-yl)-N-[(2R)-1-(1-oxophthalazin-2-yl)butan-2-yl]acetamide.
| Compound Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-[(2R)-1-(1-oxophthalazin-2-yl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 16671484 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-[(2R)-1-(1-oxophthalazin-2-yl)butan-2-yl]acetamide |
| SMILES | CC[C@H](Cn1ncc2ccccc2c1=O)NC(=O)Cc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H21N5O3/c1-2-15(13-27-22(30)16-8-4-3-7-14(16)12-23-27)24-20(28)11-19-17-9-5-6-10-18(17)21(29)26-25-19/h3-10,12,15H,2,11,13H2,1H3,(H,24,28)(H,26,29)/t15-/m1/s1 |
| InChIKey | YDGSXTIJWQUQSM-OAHLLOKOSA-N |
| XLogP | 1.77 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |