C18H16N4O4 — CID 21213715
4-methoxy-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide (PubChem CID 21213715) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-methoxy-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 21213715 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-methoxy-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)Cc2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C18H16N4O4/c1-26-12-8-6-11(7-9-12)17(24)21-20-16(23)10-15-13-4-2-3-5-14(13)18(25)22-19-15/h2-9H,10H2,1H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | FSDUFQUAJBWJGU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|