C14H14N2O5 — CID 63898896
ethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)-3-oxobutanoate (PubChem CID 63898896) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is ethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 63898896 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | ethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C14H14N2O5/c1-2-21-12(18)7-9(17)8-16-14(20)11-6-4-3-5-10(11)13(19)15-16/h3-6H,2,7-8H2,1H3,(H,15,19) |
| InChIKey | ZSKPUTYKFMVSGQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|