C22H25N3O5 — CID 9418997
N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide (PubChem CID 9418997) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide.
| Compound Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 9418997 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)cc1OCC |
| InChI | InChI=1S/C22H25N3O5/c1-4-29-18-11-10-15(12-19(18)30-5-2)14(3)23-20(26)13-25-22(28)17-9-7-6-8-16(17)21(27)24-25/h6-12,14H,4-5,13H2,1-3H3,(H,23,26)(H,24,27)/t14-/m1/s1 |
| InChIKey | NTCBOTQJYOYYTJ-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |