C29H32N2O4 — CID 55502933
N-[1-(3,4-dipropoxyphenyl)ethyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 55502933) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[1-(3,4-dipropoxyphenyl)ethyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[1-(3,4-dipropoxyphenyl)ethyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 55502933 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | N-[1-(3,4-dipropoxyphenyl)ethyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1OCCC |
| InChI | InChI=1S/C29H32N2O4/c1-4-16-34-26-15-14-21(18-27(26)35-17-5-2)20(3)30-28(32)19-31-24-12-8-6-10-22(24)29(33)23-11-7-9-13-25(23)31/h6-15,18,20H,4-5,16-17,19H2,1-3H3,(H,30,32) |
| InChIKey | RXLJIELXEOHXNI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|