C24H29N3O4 — CID 9109111
N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 9109111) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9109111 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCCOc1ccc([C@H](C)NC(=O)c2nn(C)c(=O)c3ccccc23)cc1OCCC |
| InChI | InChI=1S/C24H29N3O4/c1-5-13-30-20-12-11-17(15-21(20)31-14-6-2)16(3)25-23(28)22-18-9-7-8-10-19(18)24(29)27(4)26-22/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | GLGPCYYKMMNEFY-INIZCTEOSA-N |
| XLogP | 4.00 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |