C24H20F2N2O3 — CID 25337144
N-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 25337144) has the molecular formula C24H20F2N2O3 and a molecular weight of 422.43 g/mol. Its IUPAC name is N-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 25337144 |
| Molecular Formula | C24H20F2N2O3 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | C[C@@H](NC(=O)Cn1c2ccccc2c(=O)c2ccccc21)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H20F2N2O3/c1-15(16-10-12-17(13-11-16)31-24(25)26)27-22(29)14-28-20-8-4-2-6-18(20)23(30)19-7-3-5-9-21(19)28/h2-13,15,24H,14H2,1H3,(H,27,29)/t15-/m1/s1 |
| InChIKey | WKPBGTMYJZBULI-OAHLLOKOSA-N |
| XLogP | 4.63 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|