C17H12BrClN2O4 — CID 55381192
(4-bromo-2-chlorophenyl) 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate (PubChem CID 55381192) has the molecular formula C17H12BrClN2O4 and a molecular weight of 423.65 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate.
| Compound Name | (4-bromo-2-chlorophenyl) 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate |
|---|---|
| PubChem CID | 55381192 |
| Molecular Formula | C17H12BrClN2O4 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)Oc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C17H12BrClN2O4/c18-10-5-6-14(13(19)9-10)25-15(22)7-8-21-17(24)12-4-2-1-3-11(12)16(23)20-21/h1-6,9H,7-8H2,(H,20,23) |
| InChIKey | DQSPBHVKQFHRHZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|