C20H21N3O6 — CID 40723461
3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 40723461) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 40723461 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)CCn2[nH]c(=O)c3ccccc3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O6/c1-27-15-10-12(11-16(28-2)18(15)29-3)21-17(24)8-9-23-20(26)14-7-5-4-6-13(14)19(25)22-23/h4-7,10-11H,8-9H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GNZQZOTXEOFWLL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |