C15H12BrClN4O3 — CID 16591935
(4-bromo-2-chlorophenyl) 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate (PubChem CID 16591935) has the molecular formula C15H12BrClN4O3 and a molecular weight of 411.64 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate.
| Compound Name | (4-bromo-2-chlorophenyl) 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 16591935 |
| Molecular Formula | C15H12BrClN4O3 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate |
| SMILES | Cn1ncc2c(=O)n(CCC(=O)Oc3ccc(Br)cc3Cl)cnc21 |
| InChI | InChI=1S/C15H12BrClN4O3/c1-20-14-10(7-19-20)15(23)21(8-18-14)5-4-13(22)24-12-3-2-9(16)6-11(12)17/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | UJRJQBTXDQBHQA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|