C17H19N3O5 — CID 120694287
(E)-2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]hex-4-enoic acid (PubChem CID 120694287) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is (E)-2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]hex-4-enoic acid.
| Compound Name | (E)-2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694287 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (E)-2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CCn1[nH]c(=O)c2ccccc2c1=O)C(=O)O |
| InChI | InChI=1S/C17H19N3O5/c1-2-3-8-13(17(24)25)18-14(21)9-10-20-16(23)12-7-5-4-6-11(12)15(22)19-20/h2-7,13H,8-10H2,1H3,(H,18,21)(H,19,22)(H,24,25)/b3-2+ |
| InChIKey | XQHHAOZJLNPMQD-NSCUHMNNSA-N |
| XLogP | 0.62 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|