C14H18N4O3 — CID 119406745
N-(3-aminopropyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide (PubChem CID 119406745) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide.
| Compound Name | N-(3-aminopropyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
|---|---|
| PubChem CID | 119406745 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-(3-aminopropyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
| SMILES | NCCCNC(=O)CCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C14H18N4O3/c15-7-3-8-16-12(19)6-9-18-14(21)11-5-2-1-4-10(11)13(20)17-18/h1-2,4-5H,3,6-9,15H2,(H,16,19)(H,17,20) |
| InChIKey | VKDRNYGWIKKUID-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|