C23H21N3O4 — CID 55889266
3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-naphthalen-1-yloxyethyl)propanamide (PubChem CID 55889266) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-naphthalen-1-yloxyethyl)propanamide.
| Compound Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-naphthalen-1-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 55889266 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-naphthalen-1-yloxyethyl)propanamide |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)NCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C23H21N3O4/c27-21(12-14-26-23(29)19-10-4-3-9-18(19)22(28)25-26)24-13-15-30-20-11-5-7-16-6-1-2-8-17(16)20/h1-11H,12-15H2,(H,24,27)(H,25,28) |
| InChIKey | ZKOJMDSPBSFPTO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|