C14H17N3O3S — CID 118775384
N-[2-(1,4-dioxo-3H-phthalazin-2-yl)ethyl]-2-ethylsulfanylacetamide (PubChem CID 118775384) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[2-(1,4-dioxo-3H-phthalazin-2-yl)ethyl]-2-ethylsulfanylacetamide.
| Compound Name | N-[2-(1,4-dioxo-3H-phthalazin-2-yl)ethyl]-2-ethylsulfanylacetamide |
|---|---|
| PubChem CID | 118775384 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2-(1,4-dioxo-3H-phthalazin-2-yl)ethyl]-2-ethylsulfanylacetamide |
| SMILES | CCSCC(=O)NCCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C14H17N3O3S/c1-2-21-9-12(18)15-7-8-17-14(20)11-6-4-3-5-10(11)13(19)16-17/h3-6H,2,7-9H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | FWOBRUKHOLRECP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |