C17H21N3O3 — CID 39210877
N-(cyclopentylmethyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide (PubChem CID 39210877) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide.
| Compound Name | N-(cyclopentylmethyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
|---|---|
| PubChem CID | 39210877 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(cyclopentylmethyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)NCC1CCCC1 |
| InChI | InChI=1S/C17H21N3O3/c21-15(18-11-12-5-1-2-6-12)9-10-20-17(23)14-8-4-3-7-13(14)16(22)19-20/h3-4,7-8,12H,1-2,5-6,9-11H2,(H,18,21)(H,19,22) |
| InChIKey | SXTARZBFLKOCAV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |