C19H25N3O3 — CID 24632559
N-cyclohexyl-3-(1,4-dioxo-3H-phthalazin-2-yl)-N-ethylpropanamide (PubChem CID 24632559) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-cyclohexyl-3-(1,4-dioxo-3H-phthalazin-2-yl)-N-ethylpropanamide.
| Compound Name | N-cyclohexyl-3-(1,4-dioxo-3H-phthalazin-2-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 24632559 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-cyclohexyl-3-(1,4-dioxo-3H-phthalazin-2-yl)-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCn1[nH]c(=O)c2ccccc2c1=O)C1CCCCC1 |
| InChI | InChI=1S/C19H25N3O3/c1-2-21(14-8-4-3-5-9-14)17(23)12-13-22-19(25)16-11-7-6-10-15(16)18(24)20-22/h6-7,10-11,14H,2-5,8-9,12-13H2,1H3,(H,20,24) |
| InChIKey | XSBDTNYLSFRNFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |