C18H16FN3O3 — CID 40723465
3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-fluoro-4-methylphenyl)propanamide (PubChem CID 40723465) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-fluoro-4-methylphenyl)propanamide.
| Compound Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-fluoro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 40723465 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(2-fluoro-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCn2[nH]c(=O)c3ccccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C18H16FN3O3/c1-11-6-7-15(14(19)10-11)20-16(23)8-9-22-18(25)13-5-3-2-4-12(13)17(24)21-22/h2-7,10H,8-9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | RUNALDJRGNJQHH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |