C25H28N4O4 — CID 55879295
N-cyclohexyl-4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylbenzamide (PubChem CID 55879295) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-cyclohexyl-4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylbenzamide.
| Compound Name | N-cyclohexyl-4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylbenzamide |
|---|---|
| PubChem CID | 55879295 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-cyclohexyl-4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)ccc1NC(=O)CCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C25H28N4O4/c1-16-15-17(23(31)26-18-7-3-2-4-8-18)11-12-21(16)27-22(30)13-14-29-25(33)20-10-6-5-9-19(20)24(32)28-29/h5-6,9-12,15,18H,2-4,7-8,13-14H2,1H3,(H,26,31)(H,27,30)(H,28,32) |
| InChIKey | FVEGNAJZKUPEMV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |