C19H27N3O4 — CID 51121340
methyl N-[2-[4-(cyclohexylcarbamoyl)-2-methylanilino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 51121340) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl N-[2-[4-(cyclohexylcarbamoyl)-2-methylanilino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | methyl N-[2-[4-(cyclohexylcarbamoyl)-2-methylanilino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 51121340 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | methyl N-[2-[4-(cyclohexylcarbamoyl)-2-methylanilino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)CC(=O)Nc1ccc(C(=O)NC2CCCCC2)cc1C |
| InChI | InChI=1S/C19H27N3O4/c1-13-11-14(18(24)20-15-7-5-4-6-8-15)9-10-16(13)21-17(23)12-22(2)19(25)26-3/h9-11,15H,4-8,12H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | WFKKFFVJVWQHAW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |