C22H19BrN4O4 — CID 108924041
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide (PubChem CID 108924041) has the molecular formula C22H19BrN4O4 and a molecular weight of 483.32 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 108924041 |
| Molecular Formula | C22H19BrN4O4 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide |
| SMILES | N#CCC(=O)Nc1cccc(CNC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)c1 |
| InChI | InChI=1S/C22H19BrN4O4/c23-15-6-7-17-18(12-15)22(31)27(21(17)30)10-2-5-19(28)25-13-14-3-1-4-16(11-14)26-20(29)8-9-24/h1,3-4,6-7,11-12H,2,5,8,10,13H2,(H,25,28)(H,26,29) |
| InChIKey | WVWAZUQZHNPTCW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|