C15H20N2O5S — CID 58772712
methyl 3-[5-(3-oxomorpholin-4-yl)pentanoylamino]thiophene-2-carboxylate (PubChem CID 58772712) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 3-[5-(3-oxomorpholin-4-yl)pentanoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[5-(3-oxomorpholin-4-yl)pentanoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 58772712 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 3-[5-(3-oxomorpholin-4-yl)pentanoylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CCCCN1CCOCC1=O |
| InChI | InChI=1S/C15H20N2O5S/c1-21-15(20)14-11(5-9-23-14)16-12(18)4-2-3-6-17-7-8-22-10-13(17)19/h5,9H,2-4,6-8,10H2,1H3,(H,16,18) |
| InChIKey | HBGSVJIUQLQXGD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|