C23H24BrN3O3 — CID 55677050
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]butanamide (PubChem CID 55677050) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55677050 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)Nc1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C23H24BrN3O3/c24-17-9-10-18-19(14-17)23(30)27(22(18)29)13-5-8-21(28)25-20-7-2-1-6-16(20)15-26-11-3-4-12-26/h1-2,6-7,9-10,14H,3-5,8,11-13,15H2,(H,25,28) |
| InChIKey | BEFAUIJJEZVBQK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|