C24H27BrN4O3 — CID 39727631
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]butanamide (PubChem CID 39727631) has the molecular formula C24H27BrN4O3 and a molecular weight of 499.41 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 39727631 |
| Molecular Formula | C24H27BrN4O3 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]butanamide |
| SMILES | Cc1cc(NC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C24H27BrN4O3/c1-16-14-18(6-8-21(16)28-12-10-27(2)11-13-28)26-22(30)4-3-9-29-23(31)19-7-5-17(25)15-20(19)24(29)32/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,26,30) |
| InChIKey | KFWFVEFCBWDXBH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|