C27H24N2O7 — CID 17341663
3-[[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]-2-methylbenzoic acid (PubChem CID 17341663) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is 3-[[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]-2-methylbenzoic acid.
| Compound Name | 3-[[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 17341663 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 3-[[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]-2-methylbenzoic acid |
| SMILES | COc1ccc(CCN2C(=O)c3ccc(C(=O)Nc4cccc(C(=O)O)c4C)cc3C2=O)cc1OC |
| InChI | InChI=1S/C27H24N2O7/c1-15-18(27(33)34)5-4-6-21(15)28-24(30)17-8-9-19-20(14-17)26(32)29(25(19)31)12-11-16-7-10-22(35-2)23(13-16)36-3/h4-10,13-14H,11-12H2,1-3H3,(H,28,30)(H,33,34) |
| InChIKey | PYTHVMJFNXUYRJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|