C25H26N2O8 — CID 17342143
4,5-dimethoxy-2-[[2-[2-(oxan-4-yl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 17342143) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[[2-[2-(oxan-4-yl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4,5-dimethoxy-2-[[2-[2-(oxan-4-yl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 17342143 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4,5-dimethoxy-2-[[2-[2-(oxan-4-yl)ethyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | COc1cc(NC(=O)c2ccc3c(c2)C(=O)N(CCC2CCOCC2)C3=O)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C25H26N2O8/c1-33-20-12-18(25(31)32)19(13-21(20)34-2)26-22(28)15-3-4-16-17(11-15)24(30)27(23(16)29)8-5-14-6-9-35-10-7-14/h3-4,11-14H,5-10H2,1-2H3,(H,26,28)(H,31,32) |
| InChIKey | MQLWSALIJFHIFN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_acid_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|