C22H23ClN2O7 — CID 55308886
[2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 55308886) has the molecular formula C22H23ClN2O7 and a molecular weight of 462.89 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 55308886 |
| Molecular Formula | C22H23ClN2O7 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc(OCC(=O)Nc2cc(Cl)ccc2OC)c(OC)c1 |
| InChI | InChI=1S/C22H23ClN2O7/c1-4-9-24-20(26)12-32-22(28)14-5-7-18(19(10-14)30-3)31-13-21(27)25-16-11-15(23)6-8-17(16)29-2/h4-8,10-11H,1,9,12-13H2,2-3H3,(H,24,26)(H,25,27) |
| InChIKey | ZJPVHXCMWUEGGY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|