C19H22ClN3O5 — CID 55350863
3-chloro-4-ethoxy-5-methoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide (PubChem CID 55350863) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55350863 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N'-[2-(4-methoxyanilino)acetyl]benzohydrazide |
| SMILES | CCOc1c(Cl)cc(C(=O)NNC(=O)CNc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C19H22ClN3O5/c1-4-28-18-15(20)9-12(10-16(18)27-3)19(25)23-22-17(24)11-21-13-5-7-14(26-2)8-6-13/h5-10,21H,4,11H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | OBELXUDLMSRLOP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|