C21H25ClN4O5S — CID 55350678
4-chloro-N'-[2-(4-methoxyanilino)acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 55350678) has the molecular formula C21H25ClN4O5S and a molecular weight of 480.97 g/mol. Its IUPAC name is 4-chloro-N'-[2-(4-methoxyanilino)acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 4-chloro-N'-[2-(4-methoxyanilino)acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 55350678 |
| Molecular Formula | C21H25ClN4O5S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-chloro-N'-[2-(4-methoxyanilino)acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H25ClN4O5S/c1-31-17-8-6-16(7-9-17)23-14-20(27)24-25-21(28)15-5-10-18(22)19(13-15)32(29,30)26-11-3-2-4-12-26/h5-10,13,23H,2-4,11-12,14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | XJYMNHYLHKRQKV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|