C22H28N4O5S — CID 55350935
N'-[2-(4-methoxyanilino)acetyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzohydrazide (PubChem CID 55350935) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is N'-[2-(4-methoxyanilino)acetyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzohydrazide.
| Compound Name | N'-[2-(4-methoxyanilino)acetyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 55350935 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N'-[2-(4-methoxyanilino)acetyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N4O5S/c1-16-11-13-26(14-12-16)32(29,30)20-9-3-17(4-10-20)22(28)25-24-21(27)15-23-18-5-7-19(31-2)8-6-18/h3-10,16,23H,11-15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | ARKQYZFNJRNPSF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|