C22H21Cl2N5O3 — CID 55629182
5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]pyrazole-4-carbohydrazide (PubChem CID 55629182) has the molecular formula C22H21Cl2N5O3 and a molecular weight of 474.35 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]pyrazole-4-carbohydrazide.
| Compound Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55629182 |
| Molecular Formula | C22H21Cl2N5O3 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-methoxyanilino)acetyl]pyrazole-4-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2cnn(-c3ccc(Cl)cc3Cl)c2C2CC2)cc1 |
| InChI | InChI=1S/C22H21Cl2N5O3/c1-32-16-7-5-15(6-8-16)25-12-20(30)27-28-22(31)17-11-26-29(21(17)13-2-3-13)19-9-4-14(23)10-18(19)24/h4-11,13,25H,2-3,12H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | RRHMKJMSJGNNTR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|