C21H17Cl2FN4O2 — CID 55616369
5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-4-carbohydrazide (PubChem CID 55616369) has the molecular formula C21H17Cl2FN4O2 and a molecular weight of 447.30 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-4-carbohydrazide.
| Compound Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55616369 |
| Molecular Formula | C21H17Cl2FN4O2 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-4-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1cnn(-c2ccc(Cl)cc2Cl)c1C1CC1 |
| InChI | InChI=1S/C21H17Cl2FN4O2/c22-14-5-8-18(17(23)10-14)28-20(13-3-4-13)16(11-25-28)21(30)27-26-19(29)9-12-1-6-15(24)7-2-12/h1-2,5-8,10-11,13H,3-4,9H2,(H,26,29)(H,27,30) |
| InChIKey | VUQXXSQNBYLHLJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|