C13H12Cl2N2O — CID 66438989
[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methanol (PubChem CID 66438989) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is [5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methanol.
| Compound Name | [5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 66438989 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | [5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methanol |
| SMILES | OCc1cnn(-c2ccc(Cl)cc2Cl)c1C1CC1 |
| InChI | InChI=1S/C13H12Cl2N2O/c14-10-3-4-12(11(15)5-10)17-13(8-1-2-8)9(7-18)6-16-17/h3-6,8,18H,1-2,7H2 |
| InChIKey | ILDPLCDOYLBITG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |