C18H20Cl2N4O3 — CID 56558481
ethyl N-[2-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 56558481) has the molecular formula C18H20Cl2N4O3 and a molecular weight of 411.29 g/mol. Its IUPAC name is ethyl N-[2-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56558481 |
| Molecular Formula | C18H20Cl2N4O3 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | ethyl N-[2-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1cnn(-c2ccc(Cl)cc2Cl)c1C1CC1 |
| InChI | InChI=1S/C18H20Cl2N4O3/c1-2-27-18(26)22-8-7-21-17(25)13-10-23-24(16(13)11-3-4-11)15-6-5-12(19)9-14(15)20/h5-6,9-11H,2-4,7-8H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | UEJMCASHSVVDCK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|